C8H13NO2 — CID 144703329
N-[(1Z,3E)-3-ethoxyhexa-1,3,5-trienyl]hydroxylamine (PubChem CID 144703329) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is N-[(1Z,3E)-3-ethoxyhexa-1,3,5-trienyl]hydroxylamine.
| Compound Name | N-[(1Z,3E)-3-ethoxyhexa-1,3,5-trienyl]hydroxylamine |
|---|---|
| PubChem CID | 144703329 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | N-[(1Z,3E)-3-ethoxyhexa-1,3,5-trienyl]hydroxylamine |
| SMILES | C=C/C=C(\C=C/NO)OCC |
| InChI | InChI=1S/C8H13NO2/c1-3-5-8(11-4-2)6-7-9-10/h3,5-7,9-10H,1,4H2,2H3/b7-6-,8-5+ |
| InChIKey | RYCSJXKDIRWCEZ-WNXMRAAYSA-N |
| XLogP | 1.59 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|