C20H25FN6 — CID 130358634
3-fluoro-9,15-dimethyl-9,12,15,19,20,23-hexazatetracyclo[14.5.2.12,6.019,22]tetracosa-1(22),2,4,6(24),16(23),17,20-heptaene (PubChem CID 130358634) has the molecular formula C20H25FN6 and a molecular weight of 368.46 g/mol. Its IUPAC name is 3-fluoro-9,15-dimethyl-9,12,15,19,20,23-hexazatetracyclo[14.5.2.12,6.019,22]tetracosa-1(22),2,4,6(24),16(23),17,20-heptaene.
| Compound Name | 3-fluoro-9,15-dimethyl-9,12,15,19,20,23-hexazatetracyclo[14.5.2.12,6.019,22]tetracosa-1(22),2,4,6(24),16(23),17,20-heptaene |
|---|---|
| PubChem CID | 130358634 |
| Molecular Formula | C20H25FN6 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3-fluoro-9,15-dimethyl-9,12,15,19,20,23-hexazatetracyclo[14.5.2.12,6.019,22]tetracosa-1(22),2,4,6(24),16(23),17,20-heptaene |
| SMILES | CN1CCNCCN(C)c2ccn3ncc(c3n2)-c2cc(ccc2F)CC1 |
| InChI | InChI=1S/C20H25FN6/c1-25-9-5-15-3-4-18(21)16(13-15)17-14-23-27-10-6-19(24-20(17)27)26(2)12-8-22-7-11-25/h3-4,6,10,13-14,22H,5,7-9,11-12H2,1-2H3 |
| InChIKey | POVRJAMWSHOKSG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 48.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |