C17H18O6 — CID 130359457
2-[[(3R,5R,7S,8R,9S)-8,9-dimethyl-2,6-dioxatricyclo[3.3.1.03,7]nonan-4-yl]oxycarbonyl]benzoic acid (PubChem CID 130359457) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-[[(3R,5R,7S,8R,9S)-8,9-dimethyl-2,6-dioxatricyclo[3.3.1.03,7]nonan-4-yl]oxycarbonyl]benzoic acid.
| Compound Name | 2-[[(3R,5R,7S,8R,9S)-8,9-dimethyl-2,6-dioxatricyclo[3.3.1.03,7]nonan-4-yl]oxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 130359457 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-[[(3R,5R,7S,8R,9S)-8,9-dimethyl-2,6-dioxatricyclo[3.3.1.03,7]nonan-4-yl]oxycarbonyl]benzoic acid |
| SMILES | C[C@@H]1C2O[C@H]3C(OC(=O)c4ccccc4C(=O)O)[C@H](O[C@@H]13)[C@H]2C |
| InChI | InChI=1S/C17H18O6/c1-7-11-8(2)13-15(14(21-11)12(7)22-13)23-17(20)10-6-4-3-5-9(10)16(18)19/h3-8,11-15H,1-2H3,(H,18,19)/t7-,8+,11?,12+,13-,14-,15?/m1/s1 |
| InChIKey | JHCWVMLVQJUOMV-HLCTZVMOSA-N |
| XLogP | 1.73 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |