C20H20F3N5O2 — CID 130363269
4-[3-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-2,2,6-trimethylmorpholin-3-one (PubChem CID 130363269) has the molecular formula C20H20F3N5O2 and a molecular weight of 419.41 g/mol. Its IUPAC name is 4-[3-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-2,2,6-trimethylmorpholin-3-one.
| Compound Name | 4-[3-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-2,2,6-trimethylmorpholin-3-one |
|---|---|
| PubChem CID | 130363269 |
| Molecular Formula | C20H20F3N5O2 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 4-[3-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-2,2,6-trimethylmorpholin-3-one |
| SMILES | CC1CN(c2cccc(-c3cc(C(F)(F)F)c4c(N)ncnn34)c2)C(=O)C(C)(C)O1 |
| InChI | InChI=1S/C20H20F3N5O2/c1-11-9-27(18(29)19(2,3)30-11)13-6-4-5-12(7-13)15-8-14(20(21,22)23)16-17(24)25-10-26-28(15)16/h4-8,10-11H,9H2,1-3H3,(H2,24,25,26) |
| InChIKey | TZAWMUUMFQUZLR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |