C23H24F4N6O4S — CID 130363252
1-[5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-3,3,6-trimethyl-4-(2-methylsulfonylacetyl)piperazin-2-one (PubChem CID 130363252) has the molecular formula C23H24F4N6O4S and a molecular weight of 556.54 g/mol. Its IUPAC name is 1-[5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-3,3,6-trimethyl-4-(2-methylsulfonylacetyl)piperazin-2-one.
| Compound Name | 1-[5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-3,3,6-trimethyl-4-(2-methylsulfonylacetyl)piperazin-2-one |
|---|---|
| PubChem CID | 130363252 |
| Molecular Formula | C23H24F4N6O4S |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 1-[5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-3,3,6-trimethyl-4-(2-methylsulfonylacetyl)piperazin-2-one |
| SMILES | CC1CN(C(=O)CS(C)(=O)=O)C(C)(C)C(=O)N1c1cc(-c2cc(C(F)(F)F)c3c(N)ncnn23)ccc1F |
| InChI | InChI=1S/C23H24F4N6O4S/c1-12-9-31(18(34)10-38(4,36)37)22(2,3)21(35)32(12)17-7-13(5-6-15(17)24)16-8-14(23(25,26)27)19-20(28)29-11-30-33(16)19/h5-8,11-12H,9-10H2,1-4H3,(H2,28,29,30) |
| InChIKey | SVWAGFPANVEFPR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 130.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |