C23H25N7O4S — CID 130363259
7-[3-[(6S)-4-acetyl-3,3,6-trimethyl-2-oxopiperazin-1-yl]-4-methylsulfonylphenyl]-4-aminopyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile (PubChem CID 130363259) has the molecular formula C23H25N7O4S and a molecular weight of 495.57 g/mol. Its IUPAC name is 7-[3-[(6S)-4-acetyl-3,3,6-trimethyl-2-oxopiperazin-1-yl]-4-methylsulfonylphenyl]-4-aminopyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile.
| Compound Name | 7-[3-[(6S)-4-acetyl-3,3,6-trimethyl-2-oxopiperazin-1-yl]-4-methylsulfonylphenyl]-4-aminopyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile |
|---|---|
| PubChem CID | 130363259 |
| Molecular Formula | C23H25N7O4S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 7-[3-[(6S)-4-acetyl-3,3,6-trimethyl-2-oxopiperazin-1-yl]-4-methylsulfonylphenyl]-4-aminopyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile |
| SMILES | CC(=O)N1C[C@H](C)N(c2cc(-c3cc(C#N)c4c(N)ncnn34)ccc2S(C)(=O)=O)C(=O)C1(C)C |
| InChI | InChI=1S/C23H25N7O4S/c1-13-11-28(14(2)31)23(3,4)22(32)29(13)18-8-15(6-7-19(18)35(5,33)34)17-9-16(10-24)20-21(25)26-12-27-30(17)20/h6-9,12-13H,11H2,1-5H3,(H2,25,26,27)/t13-/m0/s1 |
| InChIKey | DLXBXHIFZAZAOM-ZDUSSCGKSA-N |
| XLogP | 1.62 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |