C23H24ClN7O4S — CID 130363438
4-(4-amino-5-chloropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-[(6S)-3,3,6-trimethyl-4-(2-methylsulfonylacetyl)-2-oxopiperazin-1-yl]benzonitrile (PubChem CID 130363438) has the molecular formula C23H24ClN7O4S and a molecular weight of 530.01 g/mol. Its IUPAC name is 4-(4-amino-5-chloropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-[(6S)-3,3,6-trimethyl-4-(2-methylsulfonylacetyl)-2-oxopiperazin-1-yl]benzonitrile.
| Compound Name | 4-(4-amino-5-chloropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-[(6S)-3,3,6-trimethyl-4-(2-methylsulfonylacetyl)-2-oxopiperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 130363438 |
| Molecular Formula | C23H24ClN7O4S |
| Molecular Weight | 530.01 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 4-(4-amino-5-chloropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-[(6S)-3,3,6-trimethyl-4-(2-methylsulfonylacetyl)-2-oxopiperazin-1-yl]benzonitrile |
| SMILES | C[C@H]1CN(C(=O)CS(C)(=O)=O)C(C)(C)C(=O)N1c1cc(-c2cc(Cl)c3c(N)ncnn23)ccc1C#N |
| InChI | InChI=1S/C23H24ClN7O4S/c1-13-10-29(19(32)11-36(4,34)35)23(2,3)22(33)30(13)17-7-14(5-6-15(17)9-25)18-8-16(24)20-21(26)27-12-28-31(18)20/h5-8,12-13H,10-11H2,1-4H3,(H2,26,27,28)/t13-/m0/s1 |
| InChIKey | AMCBJLGFWBNMTM-ZDUSSCGKSA-N |
| XLogP | 1.89 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.01 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |