C22H20F3N7O2 — CID 130362974
2-[(3R,6R)-4-acetyl-3,6-dimethyl-2-oxopiperazin-1-yl]-4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzonitrile (PubChem CID 130362974) has the molecular formula C22H20F3N7O2 and a molecular weight of 471.44 g/mol. Its IUPAC name is 2-[(3R,6R)-4-acetyl-3,6-dimethyl-2-oxopiperazin-1-yl]-4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzonitrile.
| Compound Name | 2-[(3R,6R)-4-acetyl-3,6-dimethyl-2-oxopiperazin-1-yl]-4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzonitrile |
|---|---|
| PubChem CID | 130362974 |
| Molecular Formula | C22H20F3N7O2 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 2-[(3R,6R)-4-acetyl-3,6-dimethyl-2-oxopiperazin-1-yl]-4-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzonitrile |
| SMILES | CC(=O)N1C[C@@H](C)N(c2cc(-c3cc(C(F)(F)F)c4c(N)ncnn34)ccc2C#N)C(=O)[C@H]1C |
| InChI | InChI=1S/C22H20F3N7O2/c1-11-9-30(13(3)33)12(2)21(34)31(11)17-6-14(4-5-15(17)8-26)18-7-16(22(23,24)25)19-20(27)28-10-29-32(18)19/h4-7,10-12H,9H2,1-3H3,(H2,27,28,29)/t11-,12-/m1/s1 |
| InChIKey | GJWLYVODYNDQSW-VXGBXAGGSA-N |
| XLogP | 2.84 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |