C21H22F3N5O4S — CID 130363303
4-[5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methylsulfonylphenyl]-2,2,5-trimethylmorpholin-3-one (PubChem CID 130363303) has the molecular formula C21H22F3N5O4S and a molecular weight of 497.50 g/mol. Its IUPAC name is 4-[5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methylsulfonylphenyl]-2,2,5-trimethylmorpholin-3-one.
| Compound Name | 4-[5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methylsulfonylphenyl]-2,2,5-trimethylmorpholin-3-one |
|---|---|
| PubChem CID | 130363303 |
| Molecular Formula | C21H22F3N5O4S |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 4-[5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methylsulfonylphenyl]-2,2,5-trimethylmorpholin-3-one |
| SMILES | CC1COC(C)(C)C(=O)N1c1cc(-c2cc(C(F)(F)F)c3c(N)ncnn23)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C21H22F3N5O4S/c1-11-9-33-20(2,3)19(30)28(11)15-7-12(5-6-16(15)34(4,31)32)14-8-13(21(22,23)24)17-18(25)26-10-27-29(14)17/h5-8,10-11H,9H2,1-4H3,(H2,25,26,27) |
| InChIKey | ZPGGMNYQICSUJI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |