C24H25N7O2S — CID 130363527
4-acetyl-1-[3-[4-amino-5-(2-methyl-1,3-thiazol-5-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3,3-dimethylpiperazin-2-one (PubChem CID 130363527) has the molecular formula C24H25N7O2S and a molecular weight of 475.58 g/mol. Its IUPAC name is 4-acetyl-1-[3-[4-amino-5-(2-methyl-1,3-thiazol-5-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-acetyl-1-[3-[4-amino-5-(2-methyl-1,3-thiazol-5-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 130363527 |
| Molecular Formula | C24H25N7O2S |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 4-acetyl-1-[3-[4-amino-5-(2-methyl-1,3-thiazol-5-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3,3-dimethylpiperazin-2-one |
| SMILES | CC(=O)N1CCN(c2cccc(-c3cc(-c4cnc(C)s4)c4c(N)ncnn34)c2)C(=O)C1(C)C |
| InChI | InChI=1S/C24H25N7O2S/c1-14-26-12-20(34-14)18-11-19(31-21(18)22(25)27-13-28-31)16-6-5-7-17(10-16)29-8-9-30(15(2)32)24(3,4)23(29)33/h5-7,10-13H,8-9H2,1-4H3,(H2,25,27,28) |
| InChIKey | CBWPTTRUAZHEAA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |