C26H30N8O2 — CID 158688540
4-acetyl-1-[3-[4-amino-5-[2-(1,1,1,2-tetradeuteriopropan-2-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3,3-dimethylpiperazin-2-one (PubChem CID 158688540) has the molecular formula C26H30N8O2 and a molecular weight of 490.60 g/mol. Its IUPAC name is 4-acetyl-1-[3-[4-amino-5-[2-(1,1,1,2-tetradeuteriopropan-2-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-acetyl-1-[3-[4-amino-5-[2-(1,1,1,2-tetradeuteriopropan-2-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 158688540 |
| Molecular Formula | C26H30N8O2 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 4-acetyl-1-[3-[4-amino-5-[2-(1,1,1,2-tetradeuteriopropan-2-yl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3,3-dimethylpiperazin-2-one |
| SMILES | [2H]C([2H])([2H])C([2H])(C)n1nccc1-c1cc(-c2cccc(N3CCN(C(C)=O)C(C)(C)C3=O)c2)n2ncnc(N)c12 |
| InChI | InChI=1S/C26H30N8O2/c1-16(2)33-21(9-10-29-33)20-14-22(34-23(20)24(27)28-15-30-34)18-7-6-8-19(13-18)31-11-12-32(17(3)35)26(4,5)25(31)36/h6-10,13-16H,11-12H2,1-5H3,(H2,27,28,30)/i1D3,16D |
| InChIKey | IGAXHBKTZPFLLK-KFHHUZHISA-N |
| XLogP | 3.40 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |