C26H27F3N8O2 — CID 130363315
4-acetyl-1-[5-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methylphenyl]-3,3-dimethylpiperazin-2-one (PubChem CID 130363315) has the molecular formula C26H27F3N8O2 and a molecular weight of 540.55 g/mol. Its IUPAC name is 4-acetyl-1-[5-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methylphenyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-acetyl-1-[5-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methylphenyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 130363315 |
| Molecular Formula | C26H27F3N8O2 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 4-acetyl-1-[5-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-methylphenyl]-3,3-dimethylpiperazin-2-one |
| SMILES | CC(=O)N1CCN(c2cc(-c3cc(-c4ccnn4CC(F)(F)F)c4c(N)ncnn34)ccc2C)C(=O)C1(C)C |
| InChI | InChI=1S/C26H27F3N8O2/c1-15-5-6-17(11-20(15)34-9-10-35(16(2)38)25(3,4)24(34)39)21-12-18(22-23(30)31-14-33-37(21)22)19-7-8-32-36(19)13-26(27,28)29/h5-8,11-12,14H,9-10,13H2,1-4H3,(H2,30,31,33) |
| InChIKey | HSCFDSIPJBMTGR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |