C25H27F3N8O3 — CID 162575553
methyl 4-[3-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3-hydroxy-2,2-dimethylpiperazine-1-carboxylate (PubChem CID 162575553) has the molecular formula C25H27F3N8O3 and a molecular weight of 544.54 g/mol. Its IUPAC name is methyl 4-[3-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3-hydroxy-2,2-dimethylpiperazine-1-carboxylate.
| Compound Name | methyl 4-[3-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3-hydroxy-2,2-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 162575553 |
| Molecular Formula | C25H27F3N8O3 |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | methyl 4-[3-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-3-hydroxy-2,2-dimethylpiperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(c2cccc(-c3cc(-c4ccnn4CC(F)(F)F)c4c(N)ncnn34)c2)C(O)C1(C)C |
| InChI | InChI=1S/C25H27F3N8O3/c1-24(2)22(37)33(9-10-34(24)23(38)39-3)16-6-4-5-15(11-16)19-12-17(20-21(29)30-14-32-36(19)20)18-7-8-31-35(18)13-25(26,27)28/h4-8,11-12,14,22,37H,9-10,13H2,1-3H3,(H2,29,30,32) |
| InChIKey | XMEBEAHSNZSXRG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 127.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |