C24H21F4N7O2 — CID 146645903
4-[5-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-2,2-dimethyl-5-methylidenemorpholin-3-one (PubChem CID 146645903) has the molecular formula C24H21F4N7O2 and a molecular weight of 515.47 g/mol. Its IUPAC name is 4-[5-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-2,2-dimethyl-5-methylidenemorpholin-3-one.
| Compound Name | 4-[5-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-2,2-dimethyl-5-methylidenemorpholin-3-one |
|---|---|
| PubChem CID | 146645903 |
| Molecular Formula | C24H21F4N7O2 |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 4-[5-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluorophenyl]-2,2-dimethyl-5-methylidenemorpholin-3-one |
| SMILES | C=C1COC(C)(C)C(=O)N1c1cc(-c2cc(-c3ccnn3CC(F)(F)F)c3c(N)ncnn23)ccc1F |
| InChI | InChI=1S/C24H21F4N7O2/c1-13-10-37-23(2,3)22(36)34(13)19-8-14(4-5-16(19)25)18-9-15(20-21(29)30-12-32-35(18)20)17-6-7-31-33(17)11-24(26,27)28/h4-9,12H,1,10-11H2,2-3H3,(H2,29,30,32) |
| InChIKey | SHHPIBPFHMTXBS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |