C24H23F3N8O2 — CID 139394875
(5S)-4-[4-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-pyridinyl]-5-ethenyl-2,2-dimethylmorpholin-3-one (PubChem CID 139394875) has the molecular formula C24H23F3N8O2 and a molecular weight of 512.50 g/mol. Its IUPAC name is (5S)-4-[4-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-pyridinyl]-5-ethenyl-2,2-dimethylmorpholin-3-one.
| Compound Name | (5S)-4-[4-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-pyridinyl]-5-ethenyl-2,2-dimethylmorpholin-3-one |
|---|---|
| PubChem CID | 139394875 |
| Molecular Formula | C24H23F3N8O2 |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | (5S)-4-[4-[4-amino-5-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-pyridinyl]-5-ethenyl-2,2-dimethylmorpholin-3-one |
| SMILES | C=C[C@H]1COC(C)(C)C(=O)N1c1cc(-c2cc(-c3ccnn3CC(F)(F)F)c3c(N)ncnn23)ccn1 |
| InChI | InChI=1S/C24H23F3N8O2/c1-4-15-11-37-23(2,3)22(36)34(15)19-9-14(5-7-29-19)18-10-16(20-21(28)30-13-32-35(18)20)17-6-8-31-33(17)12-24(25,26)27/h4-10,13,15H,1,11-12H2,2-3H3,(H2,28,30,32)/t15-/m0/s1 |
| InChIKey | FVBKPAPUJWCFRN-HNNXBMFYSA-N |
| XLogP | 3.50 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|