C19H20ClFN6O2 — CID 130362830
4-[5-(4-amino-5-chloro-6-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyl-3-pyridinyl]-2,2,5-trimethylmorpholin-3-one (PubChem CID 130362830) has the molecular formula C19H20ClFN6O2 and a molecular weight of 418.86 g/mol. Its IUPAC name is 4-[5-(4-amino-5-chloro-6-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyl-3-pyridinyl]-2,2,5-trimethylmorpholin-3-one.
| Compound Name | 4-[5-(4-amino-5-chloro-6-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyl-3-pyridinyl]-2,2,5-trimethylmorpholin-3-one |
|---|---|
| PubChem CID | 130362830 |
| Molecular Formula | C19H20ClFN6O2 |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 4-[5-(4-amino-5-chloro-6-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyl-3-pyridinyl]-2,2,5-trimethylmorpholin-3-one |
| SMILES | Cc1ncc(-c2c(F)c(Cl)c3c(N)ncnn23)cc1N1C(=O)C(C)(C)OCC1C |
| InChI | InChI=1S/C19H20ClFN6O2/c1-9-7-29-19(3,4)18(28)26(9)12-5-11(6-23-10(12)2)15-14(21)13(20)16-17(22)24-8-25-27(15)16/h5-6,8-9H,7H2,1-4H3,(H2,22,24,25) |
| InChIKey | WLMJGRYZVAMLRF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |