C16H23N5O2S — CID 130364549
1-cyano-N-[5-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide (PubChem CID 130364549) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-cyano-N-[5-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | 1-cyano-N-[5-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 130364549 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-cyano-N-[5-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide |
| SMILES | COCC1CCCN1Cc1cnc(NC(=O)C2CCN(C#N)C2)s1 |
| InChI | InChI=1S/C16H23N5O2S/c1-23-10-13-3-2-5-21(13)9-14-7-18-16(24-14)19-15(22)12-4-6-20(8-12)11-17/h7,12-13H,2-6,8-10H2,1H3,(H,18,19,22) |
| InChIKey | DLOJFQRZKOZSKI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|