C23H19ClFNO4 — CID 130365630
2-[3-[4-[2-chloro-5-(3-fluorophenoxy)-3-pyridinyl]phenyl]cyclobutyl]oxyacetic acid (PubChem CID 130365630) has the molecular formula C23H19ClFNO4 and a molecular weight of 427.86 g/mol. Its IUPAC name is 2-[3-[4-[2-chloro-5-(3-fluorophenoxy)-3-pyridinyl]phenyl]cyclobutyl]oxyacetic acid.
| Compound Name | 2-[3-[4-[2-chloro-5-(3-fluorophenoxy)-3-pyridinyl]phenyl]cyclobutyl]oxyacetic acid |
|---|---|
| PubChem CID | 130365630 |
| Molecular Formula | C23H19ClFNO4 |
| Molecular Weight | 427.86 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2-[3-[4-[2-chloro-5-(3-fluorophenoxy)-3-pyridinyl]phenyl]cyclobutyl]oxyacetic acid |
| SMILES | O=C(O)COC1CC(c2ccc(-c3cc(Oc4cccc(F)c4)cnc3Cl)cc2)C1 |
| InChI | InChI=1S/C23H19ClFNO4/c24-23-21(11-20(12-26-23)30-18-3-1-2-17(25)10-18)15-6-4-14(5-7-15)16-8-19(9-16)29-13-22(27)28/h1-7,10-12,16,19H,8-9,13H2,(H,27,28) |
| InChIKey | DBXZWWPONFLMDK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.86 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|