C10H20BrNO — CID 13036616
2-bromo-N,N-di(propan-2-yl)butanamide (PubChem CID 13036616) has the molecular formula C10H20BrNO and a molecular weight of 250.18 g/mol. Its IUPAC name is 2-bromo-N,N-di(propan-2-yl)butanamide.
| Compound Name | 2-bromo-N,N-di(propan-2-yl)butanamide |
|---|---|
| PubChem CID | 13036616 |
| Molecular Formula | C10H20BrNO |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-bromo-N,N-di(propan-2-yl)butanamide |
| SMILES | CCC(Br)C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C10H20BrNO/c1-6-9(11)10(13)12(7(2)3)8(4)5/h7-9H,6H2,1-5H3 |
| InChIKey | WLQTYWSUGCBMQY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|