C12H24N4O5S2 — CID 130367551
N,N-dimethyl-4-(2-sulfamoylhex-5-enoyl)piperazine-1-sulfonamide (PubChem CID 130367551) has the molecular formula C12H24N4O5S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-sulfamoylhex-5-enoyl)piperazine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-(2-sulfamoylhex-5-enoyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 130367551 |
| Molecular Formula | C12H24N4O5S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N,N-dimethyl-4-(2-sulfamoylhex-5-enoyl)piperazine-1-sulfonamide |
| SMILES | C=CCCC(C(=O)N1CCN(S(=O)(=O)N(C)C)CC1)S(N)(=O)=O |
| InChI | InChI=1S/C12H24N4O5S2/c1-4-5-6-11(22(13,18)19)12(17)15-7-9-16(10-8-15)23(20,21)14(2)3/h4,11H,1,5-10H2,2-3H3,(H2,13,18,19) |
| InChIKey | LYJAAYAFJZOYTM-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|