C25H22F4N2O5 — CID 130367941
[(2R)-1-[3,5-bis(3,4-difluorophenyl)phenoxy]-5-(carboxyamino)pentan-2-yl]carbamic acid (PubChem CID 130367941) has the molecular formula C25H22F4N2O5 and a molecular weight of 506.45 g/mol. Its IUPAC name is [(2R)-1-[3,5-bis(3,4-difluorophenyl)phenoxy]-5-(carboxyamino)pentan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-[3,5-bis(3,4-difluorophenyl)phenoxy]-5-(carboxyamino)pentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 130367941 |
| Molecular Formula | C25H22F4N2O5 |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | [(2R)-1-[3,5-bis(3,4-difluorophenyl)phenoxy]-5-(carboxyamino)pentan-2-yl]carbamic acid |
| SMILES | O=C(O)NCCC[C@H](COc1cc(-c2ccc(F)c(F)c2)cc(-c2ccc(F)c(F)c2)c1)NC(=O)O |
| InChI | InChI=1S/C25H22F4N2O5/c26-20-5-3-14(11-22(20)28)16-8-17(15-4-6-21(27)23(29)12-15)10-19(9-16)36-13-18(31-25(34)35)2-1-7-30-24(32)33/h3-6,8-12,18,30-31H,1-2,7,13H2,(H,32,33)(H,34,35)/t18-/m1/s1 |
| InChIKey | MZKIPBRUXDCJCC-GOSISDBHSA-N |
| XLogP | 5.64 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|