C11H14N2O2 — CID 130370289
(6E,7E)-7-[(Z)-but-2-enylidene]-6-ethylidene-1,4-diazepane-2,5-dione (PubChem CID 130370289) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (6E,7E)-7-[(Z)-but-2-enylidene]-6-ethylidene-1,4-diazepane-2,5-dione.
| Compound Name | (6E,7E)-7-[(Z)-but-2-enylidene]-6-ethylidene-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 130370289 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (6E,7E)-7-[(Z)-but-2-enylidene]-6-ethylidene-1,4-diazepane-2,5-dione |
| SMILES | C/C=C\C=C1\NC(=O)CNC(=O)\C1=C\C |
| InChI | InChI=1S/C11H14N2O2/c1-3-5-6-9-8(4-2)11(15)12-7-10(14)13-9/h3-6H,7H2,1-2H3,(H,12,15)(H,13,14)/b5-3-,8-4+,9-6+ |
| InChIKey | JPNBVUROEJADEE-TYKJNVJLSA-N |
| XLogP | 0.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|