C24H22I2N6O2S2 — CID 130371862
(5Z)-5-[[2-[(3S,5R)-3,5-diiodo-4-[[(6-thiophen-3-yl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 130371862) has the molecular formula C24H22I2N6O2S2 and a molecular weight of 744.42 g/mol. Its IUPAC name is (5Z)-5-[[2-[(3S,5R)-3,5-diiodo-4-[[(6-thiophen-3-yl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[(3S,5R)-3,5-diiodo-4-[[(6-thiophen-3-yl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 130371862 |
| Molecular Formula | C24H22I2N6O2S2 |
| Molecular Weight | 744.42 g/mol |
| Exact Mass | 743.93 |
| IUPAC Name | (5Z)-5-[[2-[(3S,5R)-3,5-diiodo-4-[[(6-thiophen-3-yl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccnc(N3C[C@@H](I)C(CNCc4cccc(-c5ccsc5)n4)[C@@H](I)C3)n2)S1 |
| InChI | InChI=1S/C24H22I2N6O2S2/c25-18-11-32(23-28-6-4-15(30-23)8-21-22(33)31-24(34)36-21)12-19(26)17(18)10-27-9-16-2-1-3-20(29-16)14-5-7-35-13-14/h1-8,13,17-19,27H,9-12H2,(H,31,33,34)/b21-8-/t17?,18-,19+ |
| InChIKey | YOPHOYVKVIUYQW-JPNSXPDLSA-N |
| XLogP | 4.76 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|