C25H26N6O2S2 — CID 89077775
(5E)-5-[[2-[4-[2-[(6-thiophen-2-yl-2-pyridinyl)methylamino]ethyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89077775) has the molecular formula C25H26N6O2S2 and a molecular weight of 506.66 g/mol. Its IUPAC name is (5E)-5-[[2-[4-[2-[(6-thiophen-2-yl-2-pyridinyl)methylamino]ethyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[4-[2-[(6-thiophen-2-yl-2-pyridinyl)methylamino]ethyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89077775 |
| Molecular Formula | C25H26N6O2S2 |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | (5E)-5-[[2-[4-[2-[(6-thiophen-2-yl-2-pyridinyl)methylamino]ethyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccnc(N3CCC(CCNCc4cccc(-c5cccs5)n4)CC3)n2)S1 |
| InChI | InChI=1S/C25H26N6O2S2/c32-23-22(35-25(33)30-23)15-18-7-11-27-24(29-18)31-12-8-17(9-13-31)6-10-26-16-19-3-1-4-20(28-19)21-5-2-14-34-21/h1-5,7,11,14-15,17,26H,6,8-10,12-13,16H2,(H,30,32,33)/b22-15+ |
| InChIKey | ZGFLYWHBFSQPNY-PXLXIMEGSA-N |
| XLogP | 4.32 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|