C26H27N3O4 — CID 130372742
4-[[[2-[[4-(dimethylamino)phenyl]methyl-formylamino]benzoyl]-methylamino]methyl]benzoic acid (PubChem CID 130372742) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-[[[2-[[4-(dimethylamino)phenyl]methyl-formylamino]benzoyl]-methylamino]methyl]benzoic acid.
| Compound Name | 4-[[[2-[[4-(dimethylamino)phenyl]methyl-formylamino]benzoyl]-methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 130372742 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 4-[[[2-[[4-(dimethylamino)phenyl]methyl-formylamino]benzoyl]-methylamino]methyl]benzoic acid |
| SMILES | CN(Cc1ccc(C(=O)O)cc1)C(=O)c1ccccc1N(C=O)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C26H27N3O4/c1-27(2)22-14-10-20(11-15-22)17-29(18-30)24-7-5-4-6-23(24)25(31)28(3)16-19-8-12-21(13-9-19)26(32)33/h4-15,18H,16-17H2,1-3H3,(H,32,33) |
| InChIKey | QOGAMGWEPNJHTR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|