C25H25N3O4 — CID 166970617
2-[formyl-[[4-(hydroxycarbamoyl)phenyl]methyl]amino]-N-methyl-N-(2-phenylethyl)benzamide (PubChem CID 166970617) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-[formyl-[[4-(hydroxycarbamoyl)phenyl]methyl]amino]-N-methyl-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[formyl-[[4-(hydroxycarbamoyl)phenyl]methyl]amino]-N-methyl-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 166970617 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-[formyl-[[4-(hydroxycarbamoyl)phenyl]methyl]amino]-N-methyl-N-(2-phenylethyl)benzamide |
| SMILES | CN(CCc1ccccc1)C(=O)c1ccccc1N(C=O)Cc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C25H25N3O4/c1-27(16-15-19-7-3-2-4-8-19)25(31)22-9-5-6-10-23(22)28(18-29)17-20-11-13-21(14-12-20)24(30)26-32/h2-14,18,32H,15-17H2,1H3,(H,26,30) |
| InChIKey | GQRPTOCFOKEEIL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|