C32H31N3O3 — CID 171636472
N-[2-benzamido-2-[2-[formyl(2-phenylethyl)amino]phenyl]propyl]benzamide (PubChem CID 171636472) has the molecular formula C32H31N3O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is N-[2-benzamido-2-[2-[formyl(2-phenylethyl)amino]phenyl]propyl]benzamide.
| Compound Name | N-[2-benzamido-2-[2-[formyl(2-phenylethyl)amino]phenyl]propyl]benzamide |
|---|---|
| PubChem CID | 171636472 |
| Molecular Formula | C32H31N3O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | N-[2-benzamido-2-[2-[formyl(2-phenylethyl)amino]phenyl]propyl]benzamide |
| SMILES | CC(CNC(=O)c1ccccc1)(NC(=O)c1ccccc1)c1ccccc1N(C=O)CCc1ccccc1 |
| InChI | InChI=1S/C32H31N3O3/c1-32(34-31(38)27-17-9-4-10-18-27,23-33-30(37)26-15-7-3-8-16-26)28-19-11-12-20-29(28)35(24-36)22-21-25-13-5-2-6-14-25/h2-20,24H,21-23H2,1H3,(H,33,37)(H,34,38) |
| InChIKey | YISVKSIVLYRYAL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|