C16H29NO3 — CID 130373299
2-[(3E,5Z)-2-(4-methoxybutoxy)nona-3,5,8-trien-4-yl]oxyethanamine (PubChem CID 130373299) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is 2-[(3E,5Z)-2-(4-methoxybutoxy)nona-3,5,8-trien-4-yl]oxyethanamine.
| Compound Name | 2-[(3E,5Z)-2-(4-methoxybutoxy)nona-3,5,8-trien-4-yl]oxyethanamine |
|---|---|
| PubChem CID | 130373299 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 2-[(3E,5Z)-2-(4-methoxybutoxy)nona-3,5,8-trien-4-yl]oxyethanamine |
| SMILES | C=CC/C=C\C(=C/C(C)OCCCCOC)OCCN |
| InChI | InChI=1S/C16H29NO3/c1-4-5-6-9-16(20-13-10-17)14-15(2)19-12-8-7-11-18-3/h4,6,9,14-15H,1,5,7-8,10-13,17H2,2-3H3/b9-6-,16-14+ |
| InChIKey | VNZINNFJYSLARD-YHXYMIKWSA-N |
| XLogP | 2.81 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|