C19H29NO3 — CID 130373291
2-[3-[4-(cyclohexa-1,5-dien-1-ylmethoxy)butoxy]cyclohexa-1,3-dien-1-yl]oxyethanamine (PubChem CID 130373291) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[3-[4-(cyclohexa-1,5-dien-1-ylmethoxy)butoxy]cyclohexa-1,3-dien-1-yl]oxyethanamine.
| Compound Name | 2-[3-[4-(cyclohexa-1,5-dien-1-ylmethoxy)butoxy]cyclohexa-1,3-dien-1-yl]oxyethanamine |
|---|---|
| PubChem CID | 130373291 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 2-[3-[4-(cyclohexa-1,5-dien-1-ylmethoxy)butoxy]cyclohexa-1,3-dien-1-yl]oxyethanamine |
| SMILES | NCCOC1=CC(OCCCCOCC2=CCCC=C2)=CCC1 |
| InChI | InChI=1S/C19H29NO3/c20-11-14-23-19-10-6-9-18(15-19)22-13-5-4-12-21-16-17-7-2-1-3-8-17/h2,7-9,15H,1,3-6,10-14,16,20H2 |
| InChIKey | OYSGZXYSDJFMOV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|