C11H13NO2 — CID 46835338
(3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine (PubChem CID 46835338) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine.
| Compound Name | (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine |
|---|---|
| PubChem CID | 46835338 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine |
| SMILES | NCC1=C(C2=CC=CCC2)OC=CO1 |
| InChI | InChI=1S/C11H13NO2/c12-8-10-11(14-7-6-13-10)9-4-2-1-3-5-9/h1-2,4,6-7H,3,5,8,12H2 |
| InChIKey | JCOZBTPWNNOZBI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |