C12H15NO2 — CID 67493337
1-(5-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanamine (PubChem CID 67493337) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-(5-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanamine.
| Compound Name | 1-(5-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanamine |
|---|---|
| PubChem CID | 67493337 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-(5-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanamine |
| SMILES | CC(N)C1=COC(C2=CC=CCC2)=CO1 |
| InChI | InChI=1S/C12H15NO2/c1-9(13)11-7-15-12(8-14-11)10-5-3-2-4-6-10/h2-3,5,7-9H,4,6,13H2,1H3 |
| InChIKey | OGCIBPTZIGGHJK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |