C8H13NO2 — CID 89211055
4,5-dimethoxycyclohexa-2,4-dien-1-amine (PubChem CID 89211055) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 4,5-dimethoxycyclohexa-2,4-dien-1-amine.
| Compound Name | 4,5-dimethoxycyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 89211055 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4,5-dimethoxycyclohexa-2,4-dien-1-amine |
| SMILES | COC1=C(OC)CC(N)C=C1 |
| InChI | InChI=1S/C8H13NO2/c1-10-7-4-3-6(9)5-8(7)11-2/h3-4,6H,5,9H2,1-2H3 |
| InChIKey | OGYQDAWTNMSWLJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |