About 1-O-methyl 2-O-(methylaminomethyl) oxalate
1-O-methyl 2-O-(methylaminomethyl) oxalate (PubChem CID 130373394) has the molecular formula C5H9NO4
and a molecular weight of 147.13 g/mol. Its IUPAC name is 1-O-methyl 2-O-(methylaminomethyl) oxalate.
Molecular Properties
| Compound Name | 1-O-methyl 2-O-(methylaminomethyl) oxalate |
| PubChem CID | 130373394 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 1-O-methyl 2-O-(methylaminomethyl) oxalate |
| SMILES | CNCOC(=O)C(=O)OC |
| InChI | InChI=1S/C5H9NO4/c1-6-3-10-5(8)4(7)9-2/h6H,3H2,1-2H3 |
| InChIKey | RHXDANMQBAYQSY-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 2-O-(methylaminomethyl) oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 2-O-(methylaminomethyl) oxalate?
The IUPAC name of 1-O-methyl 2-O-(methylaminomethyl) oxalate (CID 130373394) is 1-O-methyl 2-O-(methylaminomethyl) oxalate.
What is the SMILES notation for 1-O-methyl 2-O-(methylaminomethyl) oxalate?
The canonical SMILES for 1-O-methyl 2-O-(methylaminomethyl) oxalate is CNCOC(=O)C(=O)OC.
What is the InChIKey of 1-O-methyl 2-O-(methylaminomethyl) oxalate?
The InChIKey is RHXDANMQBAYQSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4/c1-6-3-10-5(8)4(7)9-2/h6H,3H2,1-2H3.
What are the key properties of 1-O-methyl 2-O-(methylaminomethyl) oxalate?
1-O-methyl 2-O-(methylaminomethyl) oxalate has a molecular weight of 147.13 g/mol, XLogP of -1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 2-O-(methylaminomethyl) oxalate is sourced from PubChem (CID 130373394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).