C22H23N3O3S — CID 130377561
(5Z)-5-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylidene]-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-1,3-thiazol-4-one (PubChem CID 130377561) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is (5Z)-5-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylidene]-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylidene]-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 130377561 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (5Z)-5-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylidene]-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-1,3-thiazol-4-one |
| SMILES | C/C(=C1/SC(N2CCC3(CC2)OCc2ccccc23)=NC1=O)c1c(C)noc1C |
| InChI | InChI=1S/C22H23N3O3S/c1-13(18-14(2)24-28-15(18)3)19-20(26)23-21(29-19)25-10-8-22(9-11-25)17-7-5-4-6-16(17)12-27-22/h4-7H,8-12H2,1-3H3/b19-13- |
| InChIKey | NGOZZZJWUIFBFK-UYRXBGFRSA-N |
| XLogP | 4.17 |
| TPSA | 67.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|