C23H18ClF3N2O2S — CID 121335329
(5Z)-5-[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-1,3-thiazol-4-one (PubChem CID 121335329) has the molecular formula C23H18ClF3N2O2S and a molecular weight of 478.92 g/mol. Its IUPAC name is (5Z)-5-[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 121335329 |
| Molecular Formula | C23H18ClF3N2O2S |
| Molecular Weight | 478.92 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | (5Z)-5-[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCC3(CC2)OCc2ccccc23)S/C1=C(/c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H18ClF3N2O2S/c24-16-7-5-14(6-8-16)18(23(25,26)27)19-20(30)28-21(32-19)29-11-9-22(10-12-29)17-4-2-1-3-15(17)13-31-22/h1-8H,9-13H2/b19-18- |
| InChIKey | QRFXZWIHGMMTLO-HNENSFHCSA-N |
| XLogP | 5.76 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.92 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|