C19H18ClF3N4O2 — CID 154336072
N-(3-chloro-4-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-2-pyridinyl)-2,2,2-trifluoroacetohydrazide (PubChem CID 154336072) has the molecular formula C19H18ClF3N4O2 and a molecular weight of 426.83 g/mol. Its IUPAC name is N-(3-chloro-4-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-2-pyridinyl)-2,2,2-trifluoroacetohydrazide.
| Compound Name | N-(3-chloro-4-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-2-pyridinyl)-2,2,2-trifluoroacetohydrazide |
|---|---|
| PubChem CID | 154336072 |
| Molecular Formula | C19H18ClF3N4O2 |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-(3-chloro-4-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-2-pyridinyl)-2,2,2-trifluoroacetohydrazide |
| SMILES | NN(C(=O)C(F)(F)F)c1nccc(N2CCC3(CC2)OCc2ccccc23)c1Cl |
| InChI | InChI=1S/C19H18ClF3N4O2/c20-15-14(5-8-25-16(15)27(24)17(28)19(21,22)23)26-9-6-18(7-10-26)13-4-2-1-3-12(13)11-29-18/h1-5,8H,6-7,9-11,24H2 |
| InChIKey | YSPSCKIJYCDIBP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|