C21H26N2O3 — CID 130377934
tert-butyl 4-(4-carbamoylnaphthalen-1-yl)piperidine-1-carboxylate (PubChem CID 130377934) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is tert-butyl 4-(4-carbamoylnaphthalen-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-carbamoylnaphthalen-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 130377934 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | tert-butyl 4-(4-carbamoylnaphthalen-1-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(C(N)=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C21H26N2O3/c1-21(2,3)26-20(25)23-12-10-14(11-13-23)15-8-9-18(19(22)24)17-7-5-4-6-16(15)17/h4-9,14H,10-13H2,1-3H3,(H2,22,24) |
| InChIKey | GNGQSTCTVQFGAV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |