C19H24N2O4 — CID 166523451
tert-butyl 4-(7-carbamoyl-1-benzofuran-4-yl)piperidine-1-carboxylate (PubChem CID 166523451) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is tert-butyl 4-(7-carbamoyl-1-benzofuran-4-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(7-carbamoyl-1-benzofuran-4-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166523451 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | tert-butyl 4-(7-carbamoyl-1-benzofuran-4-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(C(N)=O)c3occc23)CC1 |
| InChI | InChI=1S/C19H24N2O4/c1-19(2,3)25-18(23)21-9-6-12(7-10-21)13-4-5-15(17(20)22)16-14(13)8-11-24-16/h4-5,8,11-12H,6-7,9-10H2,1-3H3,(H2,20,22) |
| InChIKey | IPFUDEWLFBUPLP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |