C15H23NO4 — CID 58442831
tert-butyl 4-[2-(hydroxymethyl)furan-3-yl]piperidine-1-carboxylate (PubChem CID 58442831) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is tert-butyl 4-[2-(hydroxymethyl)furan-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(hydroxymethyl)furan-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58442831 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | tert-butyl 4-[2-(hydroxymethyl)furan-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccoc2CO)CC1 |
| InChI | InChI=1S/C15H23NO4/c1-15(2,3)20-14(18)16-7-4-11(5-8-16)12-6-9-19-13(12)10-17/h6,9,11,17H,4-5,7-8,10H2,1-3H3 |
| InChIKey | DRNCLBJKEKKLIJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |