C32H48O4 — CID 130378775
3-[(4R)-4-[(3R,6R,7R,17R)-3,7-dihydroxy-6,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]benzoic acid (PubChem CID 130378775) has the molecular formula C32H48O4 and a molecular weight of 496.73 g/mol. Its IUPAC name is 3-[(4R)-4-[(3R,6R,7R,17R)-3,7-dihydroxy-6,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]benzoic acid.
| Compound Name | 3-[(4R)-4-[(3R,6R,7R,17R)-3,7-dihydroxy-6,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]benzoic acid |
|---|---|
| PubChem CID | 130378775 |
| Molecular Formula | C32H48O4 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | 3-[(4R)-4-[(3R,6R,7R,17R)-3,7-dihydroxy-6,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]benzoic acid |
| SMILES | C[C@H]1C(O)C2C(CCC3(C)C2CC[C@@H]3[C@H](C)CCCc2cccc(C(=O)O)c2)C2(C)CC[C@@H](O)CC12 |
| InChI | InChI=1S/C32H48O4/c1-19(7-5-8-21-9-6-10-22(17-21)30(35)36)24-11-12-25-28-26(14-16-31(24,25)3)32(4)15-13-23(33)18-27(32)20(2)29(28)34/h6,9-10,17,19-20,23-29,33-34H,5,7-8,11-16,18H2,1-4H3,(H,35,36)/t19-,20-,23-,24-,25?,26?,27?,28?,29?,31?,32?/m1/s1 |
| InChIKey | VOJYWCAOIJHMAV-MADIYKQUSA-N |
| XLogP | 6.58 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |