C26H44O3 — CID 25003146
(2R,4R)-4-[(3R,6R,7R,10S,13R,17R)-3,7-dihydroxy-6,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanal (PubChem CID 25003146) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is (2R,4R)-4-[(3R,6R,7R,10S,13R,17R)-3,7-dihydroxy-6,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanal.
| Compound Name | (2R,4R)-4-[(3R,6R,7R,10S,13R,17R)-3,7-dihydroxy-6,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanal |
|---|---|
| PubChem CID | 25003146 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | (2R,4R)-4-[(3R,6R,7R,10S,13R,17R)-3,7-dihydroxy-6,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanal |
| SMILES | C[C@H]1C(O)C2C(CC[C@@]3(C)C2CC[C@@H]3[C@H](C)C[C@@H](C)C=O)[C@@]2(C)CC[C@@H](O)CC12 |
| InChI | InChI=1S/C26H44O3/c1-15(14-27)12-16(2)19-6-7-20-23-21(9-11-25(19,20)4)26(5)10-8-18(28)13-22(26)17(3)24(23)29/h14-24,28-29H,6-13H2,1-5H3/t15-,16-,17-,18-,19-,20?,21?,22?,23?,24?,25-,26-/m1/s1 |
| InChIKey | UOKQNJAVLQVVST-WHJMLAOZSA-N |
| XLogP | 5.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|