C38H27N3O2 — CID 130379250
benzenecarboximidoyl 6-spiro[3,4-dihydrofluorene-9,9'-xanthene]-4'-ylpyridine-3-carboximidate (PubChem CID 130379250) has the molecular formula C38H27N3O2 and a molecular weight of 557.65 g/mol. Its IUPAC name is benzenecarboximidoyl 6-spiro[3,4-dihydrofluorene-9,9'-xanthene]-4'-ylpyridine-3-carboximidate.
| Compound Name | benzenecarboximidoyl 6-spiro[3,4-dihydrofluorene-9,9'-xanthene]-4'-ylpyridine-3-carboximidate |
|---|---|
| PubChem CID | 130379250 |
| Molecular Formula | C38H27N3O2 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | benzenecarboximidoyl 6-spiro[3,4-dihydrofluorene-9,9'-xanthene]-4'-ylpyridine-3-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccccc1)c1ccc(-c2cccc3c2Oc2ccccc2C32C3=C(CCC=C3)c3ccccc32)nc1 |
| InChI | InChI=1S/C38H27N3O2/c39-36(24-11-2-1-3-12-24)43-37(40)25-21-22-33(41-23-25)28-15-10-19-32-35(28)42-34-20-9-8-18-31(34)38(32)29-16-6-4-13-26(29)27-14-5-7-17-30(27)38/h1-4,6-13,15-23,39-40H,5,14H2/b39-36+,40-37- |
| InChIKey | LTTMXHDDYQGRFT-ICQVTRPHSA-N |
| XLogP | 8.67 |
| TPSA | 79.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|