C38H27N3O2 — CID 137388448
[amino(phenyl)methyl] 6-spiro[fluorene-9,9'-xanthene]-4'-ylpyridine-3-carboximidate (PubChem CID 137388448) has the molecular formula C38H27N3O2 and a molecular weight of 557.65 g/mol. Its IUPAC name is [amino(phenyl)methyl] 6-spiro[fluorene-9,9'-xanthene]-4'-ylpyridine-3-carboximidate.
| Compound Name | [amino(phenyl)methyl] 6-spiro[fluorene-9,9'-xanthene]-4'-ylpyridine-3-carboximidate |
|---|---|
| PubChem CID | 137388448 |
| Molecular Formula | C38H27N3O2 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | [amino(phenyl)methyl] 6-spiro[fluorene-9,9'-xanthene]-4'-ylpyridine-3-carboximidate |
| SMILES | [H]/N=C(\OC(N)c1ccccc1)c1ccc(-c2cccc3c2Oc2ccccc2C32c3ccccc3-c3ccccc32)nc1 |
| InChI | InChI=1S/C38H27N3O2/c39-36(24-11-2-1-3-12-24)43-37(40)25-21-22-33(41-23-25)28-15-10-19-32-35(28)42-34-20-9-8-18-31(34)38(32)29-16-6-4-13-26(29)27-14-5-7-17-30(27)38/h1-23,36,40H,39H2/b40-37- |
| InChIKey | UWFAKFMRIGSXLZ-CUXNAULPSA-N |
| XLogP | 8.22 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|