C29H26N2O2 — CID 166908466
[amino(phenyl)methyl] 4-(9,9-dimethylxanthen-3-yl)benzenecarboximidate (PubChem CID 166908466) has the molecular formula C29H26N2O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is [amino(phenyl)methyl] 4-(9,9-dimethylxanthen-3-yl)benzenecarboximidate.
| Compound Name | [amino(phenyl)methyl] 4-(9,9-dimethylxanthen-3-yl)benzenecarboximidate |
|---|---|
| PubChem CID | 166908466 |
| Molecular Formula | C29H26N2O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | [amino(phenyl)methyl] 4-(9,9-dimethylxanthen-3-yl)benzenecarboximidate |
| SMILES | [H]/N=C(\OC(N)c1ccccc1)c1ccc(-c2ccc3c(c2)Oc2ccccc2C3(C)C)cc1 |
| InChI | InChI=1S/C29H26N2O2/c1-29(2)23-10-6-7-11-25(23)32-26-18-22(16-17-24(26)29)19-12-14-21(15-13-19)28(31)33-27(30)20-8-4-3-5-9-20/h3-18,27,31H,30H2,1-2H3/b31-28- |
| InChIKey | KARTXDFTEOVCRE-PNOGMODKSA-N |
| XLogP | 6.78 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|