C46H34N4O — CID 155470657
[amino(phenyl)methyl] 6-[4-[2-phenyl-6-(2-phenylphenyl)pyrimidin-4-yl]phenyl]naphthalene-2-carboximidate (PubChem CID 155470657) has the molecular formula C46H34N4O and a molecular weight of 658.81 g/mol. Its IUPAC name is [amino(phenyl)methyl] 6-[4-[2-phenyl-6-(2-phenylphenyl)pyrimidin-4-yl]phenyl]naphthalene-2-carboximidate.
| Compound Name | [amino(phenyl)methyl] 6-[4-[2-phenyl-6-(2-phenylphenyl)pyrimidin-4-yl]phenyl]naphthalene-2-carboximidate |
|---|---|
| PubChem CID | 155470657 |
| Molecular Formula | C46H34N4O |
| Molecular Weight | 658.81 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | [amino(phenyl)methyl] 6-[4-[2-phenyl-6-(2-phenylphenyl)pyrimidin-4-yl]phenyl]naphthalene-2-carboximidate |
| SMILES | [H]/N=C(\OC(N)c1ccccc1)c1ccc2cc(-c3ccc(-c4cc(-c5ccccc5-c5ccccc5)nc(-c5ccccc5)n4)cc3)ccc2c1 |
| InChI | InChI=1S/C46H34N4O/c47-44(34-14-6-2-7-15-34)51-45(48)39-27-26-37-28-36(24-25-38(37)29-39)31-20-22-33(23-21-31)42-30-43(50-46(49-42)35-16-8-3-9-17-35)41-19-11-10-18-40(41)32-12-4-1-5-13-32/h1-30,44,48H,47H2/b48-45- |
| InChIKey | FSRKQNVDEVULBN-JPKXHTHCSA-N |
| XLogP | 10.96 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.81 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|