C54H40N4O — CID 155470700
[amino-[4-(2,6-diphenylpyrimidin-4-yl)-2,3,5,6-tetraphenylphenyl]methyl] benzenecarboximidate (PubChem CID 155470700) has the molecular formula C54H40N4O and a molecular weight of 760.94 g/mol. Its IUPAC name is [amino-[4-(2,6-diphenylpyrimidin-4-yl)-2,3,5,6-tetraphenylphenyl]methyl] benzenecarboximidate.
| Compound Name | [amino-[4-(2,6-diphenylpyrimidin-4-yl)-2,3,5,6-tetraphenylphenyl]methyl] benzenecarboximidate |
|---|---|
| PubChem CID | 155470700 |
| Molecular Formula | C54H40N4O |
| Molecular Weight | 760.94 g/mol |
| Exact Mass | 760.32 |
| IUPAC Name | [amino-[4-(2,6-diphenylpyrimidin-4-yl)-2,3,5,6-tetraphenylphenyl]methyl] benzenecarboximidate |
| SMILES | [H]/N=C(/OC(N)c1c(-c2ccccc2)c(-c2ccccc2)c(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c(-c2ccccc2)c1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H40N4O/c55-52(42-32-18-6-19-33-42)59-53(56)51-48(40-28-14-4-15-29-40)46(38-24-10-2-11-25-38)50(47(39-26-12-3-13-27-39)49(51)41-30-16-5-17-31-41)45-36-44(37-22-8-1-9-23-37)57-54(58-45)43-34-20-7-21-35-43/h1-36,53,55H,56H2/b55-52+ |
| InChIKey | NUGUXWZYKRLDDK-NBJTWIRUSA-N |
| XLogP | 13.15 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.94 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|