C46H34N4S — CID 155470469
[amino(phenyl)methyl] 4-[3-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-2-yl]benzenecarboximidothioate (PubChem CID 155470469) has the molecular formula C46H34N4S and a molecular weight of 674.87 g/mol. Its IUPAC name is [amino(phenyl)methyl] 4-[3-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-2-yl]benzenecarboximidothioate.
| Compound Name | [amino(phenyl)methyl] 4-[3-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-2-yl]benzenecarboximidothioate |
|---|---|
| PubChem CID | 155470469 |
| Molecular Formula | C46H34N4S |
| Molecular Weight | 674.87 g/mol |
| Exact Mass | 674.25 |
| IUPAC Name | [amino(phenyl)methyl] 4-[3-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-2-yl]benzenecarboximidothioate |
| SMILES | [H]/N=C(\SC(N)c1ccccc1)c1ccc(-c2cc3ccccc3cc2-c2ccccc2-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C46H34N4S/c47-44(33-16-6-2-7-17-33)51-45(48)34-26-24-31(25-27-34)40-28-36-20-10-11-21-37(36)29-41(40)38-22-12-13-23-39(38)43-30-42(32-14-4-1-5-15-32)49-46(50-43)35-18-8-3-9-19-35/h1-30,44,48H,47H2/b48-45- |
| InChIKey | DKPAXWXCYCZEAU-JPKXHTHCSA-N |
| XLogP | 11.68 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.87 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|