C43H36N4O3 — CID 166908890
[amino(phenyl)methyl] 4-[9,9-dimethyl-2-[4-(5-phenyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenyl]xanthen-3-yl]benzenecarboximidate (PubChem CID 166908890) has the molecular formula C43H36N4O3 and a molecular weight of 656.79 g/mol. Its IUPAC name is [amino(phenyl)methyl] 4-[9,9-dimethyl-2-[4-(5-phenyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenyl]xanthen-3-yl]benzenecarboximidate.
| Compound Name | [amino(phenyl)methyl] 4-[9,9-dimethyl-2-[4-(5-phenyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenyl]xanthen-3-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 166908890 |
| Molecular Formula | C43H36N4O3 |
| Molecular Weight | 656.79 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | [amino(phenyl)methyl] 4-[9,9-dimethyl-2-[4-(5-phenyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenyl]xanthen-3-yl]benzenecarboximidate |
| SMILES | [H]/N=C(\OC(N)c1ccccc1)c1ccc(-c2cc3c(cc2-c2ccc(C4NN=C(c5ccccc5)O4)cc2)C(C)(C)c2ccccc2O3)cc1 |
| InChI | InChI=1S/C43H36N4O3/c1-43(2)35-15-9-10-16-37(35)48-38-26-34(28-17-21-30(22-18-28)40(45)49-39(44)29-11-5-3-6-12-29)33(25-36(38)43)27-19-23-32(24-20-27)42-47-46-41(50-42)31-13-7-4-8-14-31/h3-26,39,42,45,47H,44H2,1-2H3/b45-40- |
| InChIKey | XPSMPVMUFNWCBW-XULXBNCXSA-N |
| XLogP | 9.43 |
| TPSA | 101.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.79 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|