C26H19ClO — CID 130380057
1-(3-chloro-5-phenylphenyl)-2-methyl-1,2-dihydrofluoren-9-one (PubChem CID 130380057) has the molecular formula C26H19ClO and a molecular weight of 382.89 g/mol. Its IUPAC name is 1-(3-chloro-5-phenylphenyl)-2-methyl-1,2-dihydrofluoren-9-one.
| Compound Name | 1-(3-chloro-5-phenylphenyl)-2-methyl-1,2-dihydrofluoren-9-one |
|---|---|
| PubChem CID | 130380057 |
| Molecular Formula | C26H19ClO |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-(3-chloro-5-phenylphenyl)-2-methyl-1,2-dihydrofluoren-9-one |
| SMILES | CC1C=CC2=C(C(=O)c3ccccc32)C1c1cc(Cl)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H19ClO/c1-16-11-12-22-21-9-5-6-10-23(21)26(28)25(22)24(16)19-13-18(14-20(27)15-19)17-7-3-2-4-8-17/h2-16,24H,1H3 |
| InChIKey | RRVBQHQUCHQGTK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |