C28H38N2O3 — CID 130382137
methyl 5'-[2,3-dimethyl-4-(methylamino)butyl]-7-methylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate (PubChem CID 130382137) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is methyl 5'-[2,3-dimethyl-4-(methylamino)butyl]-7-methylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate.
| Compound Name | methyl 5'-[2,3-dimethyl-4-(methylamino)butyl]-7-methylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
|---|---|
| PubChem CID | 130382137 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | methyl 5'-[2,3-dimethyl-4-(methylamino)butyl]-7-methylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
| SMILES | CNCC(C)C(C)CN1CC2(CCCc3cc(C)ccc32)COc2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C28H38N2O3/c1-19-8-10-24-22(13-19)7-6-12-28(24)17-30(16-21(3)20(2)15-29-4)25-14-23(27(31)32-5)9-11-26(25)33-18-28/h8-11,13-14,20-21,29H,6-7,12,15-18H2,1-5H3 |
| InChIKey | IKUCNPIIICWOSF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |